psp3dcg
psp3dcg
I'm confused with the form and meaning of bio data, could u please explain the meaning of number and alphabet? thank u~~
In FAPE loss (algorith28 in AlphaFold2 supply, page 34), why do atom coordinates need to rotate and translate based on frames generated by other atoms? I would be very appreciated...
## Context If the template database (such as pdb100) contains the structure of the query sequence, will "hhsearch" return the structure information of the query sequence as a part of...
Thanks for the really nice package! A question (rather than an issue): is there any official trained model and where does it exist in package? Thank U :)
I test the DLKcat with the substrate 'CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+]', however, I see the code of line 234 ('if smiles != None and "." not in smiles ') in 'prediction_for_input.py' indicates that...
Thank you for the open-source code! When I was using code to process uniref90 data, I found that only the first 800 residues were preserved when processing ultra long sequences,...